Compound Q&A

Is 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) safe?

Answer

4-(Difluoromethoxy)benzenesulfonyl chloride
4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) is generally safe when handled with appropriate precautions. Proper storage and handling are necessary to prevent accidental exposures. Users should follow safety guidelines and wear appropriate personal protective equipment (PPE) such as gloves and goggles. Exposure to the compound should be minimized, and spills should be cleaned up promptly following safety protocols.

About

English Name 4-(Difluoromethoxy)benzenesulfonyl chloride
Molecular Formula C7H5ClF2O3S
Molecular Weight 242.63 g/mol
SMILES C1=CC(=CC=C1OC(F)F)S(=O)(=O)Cl
InChIKey ANZLDHZFNLCQAS-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4)?

4-(Difluoromethoxy)benzenesulfonyl chloride is an organic compound with the CAS number 351003-34-4. ...

Compound Q&A

What are the main uses of 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4)?

4-(Difluoromethoxy)benzenesulfonyl chloride is primarily used as an intermediate in the synthesis of...

Compound Q&A

How should 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) be stored?

4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...