Compound Q&A

What is 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4)?

Answer

4-(Difluoromethoxy)benzenesulfonyl chloride
4-(Difluoromethoxy)benzenesulfonyl chloride is an organic compound with the CAS number 351003-34-4. It is a white or light yellow solid at room temperature. It is used in various chemical syntheses and as an intermediate in the pharmaceutical industry. The compound has a molecular formula of C8H6ClF2O3S and a molecular weight of approximately 263.17 g/mol.

About

English Name 4-(Difluoromethoxy)benzenesulfonyl chloride
Molecular Formula C7H5ClF2O3S
Molecular Weight 242.63 g/mol
SMILES C1=CC(=CC=C1OC(F)F)S(=O)(=O)Cl
InChIKey ANZLDHZFNLCQAS-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4)?

4-(Difluoromethoxy)benzenesulfonyl chloride is primarily used as an intermediate in the synthesis of...

Compound Q&A

Is 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) safe?

4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) is generally safe when handled with a...

Compound Q&A

How should 4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) be stored?

4-(Difluoromethoxy)benzenesulfonyl chloride (CAS: 351003-34-4) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...