Compound Q&A

How should 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3) be stored?

Answer

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid
2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid should be stored in a cool, dry place, preferably in a refrigerator at temperatures between 2°C and 8°C to maintain its stability. It should be kept away from direct sunlight and in a tightly sealed container to prevent degradation. Proper storage conditions are crucial to ensure the compound remains effective for its intended use.

About

English Name 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid
Molecular Formula C17H23NO4
Molecular Weight 305.37 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC=C2C(=O)O
InChIKey NPKPUCNATSURJQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3)?

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid is an organic compound with a molecular struct...

Compound Q&A

What are the main uses of 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3)?

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid is primarily used as an intermediate in the ph...

Compound Q&A

Is 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3) safe?

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid is generally considered safe when handled with...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...