Compound Q&A

What is 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3)?

Answer

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid
2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid is an organic compound with a molecular structure that combines a piperidine ring with a benzoic acid moiety. It is characterized by its aromatic properties and is used in various applications due to its chemical reactivity and stability. This compound is often used as an intermediate in the synthesis of pharmaceuticals and other organic molecules.

About

English Name 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid
Molecular Formula C17H23NO4
Molecular Weight 305.37 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC=C2C(=O)O
InChIKey NPKPUCNATSURJQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3)?

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid is primarily used as an intermediate in the ph...

Compound Q&A

Is 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3) safe?

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid is generally considered safe when handled with...

Compound Q&A

How should 2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid (CAS: 170838-26-3) be stored?

2-(1-(Tert-butoxycarbonyl)piperidin-4-YL)benzoic acid should be stored in a cool, dry place, prefera...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...