Compound Q&A

What industries use (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5)?

Answer

(2-Methylbenzyl)(triphenyl)phosphonium chloride
(2-Methylbenzyl)(triphenyl)phosphonium chloride finds application in pharmaceuticals for the synthesis of certain drugs, as a catalyst in organic synthesis, in the production of polymers for its thermal stability, and in sensors due to its reactivity with various functional groups. It is also used in the electronics industry as a precursor in semiconductor processes.

About

CAS No 63368-36-5
English Name (2-Methylbenzyl)(triphenyl)phosphonium chloride
Molecular Formula C26H24ClP
Molecular Weight 402.9 g/mol
SMILES CC1=CC=CC=C1C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
InChIKey RDHRQYBAQXBTNT-UHFFFAOYSA-M
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5)?

(2-Methylbenzyl)(triphenyl)phosphonium chloride is a crystalline compound with a molecular weight of...

Compound Q&A

How is (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5) typically synthesized?

(2-Methylbenzyl)(triphenyl)phosphonium chloride is typically synthesized by reacting 2-methylbenzyl ...

Compound Q&A

What precautions should be taken when handling (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5)?

When handling (2-Methylbenzyl)(triphenyl)phosphonium chloride, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...