Compound Q&A

What are the physical and chemical properties of (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5)?

Answer

(2-Methylbenzyl)(triphenyl)phosphonium chloride
(2-Methylbenzyl)(triphenyl)phosphonium chloride is a crystalline compound with a molecular weight of approximately 514.04 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and dichloromethane. This compound is stable under normal conditions but can react with strong bases. It is often used in organic synthesis and as a precursor in various chemical reactions.

About

CAS No 63368-36-5
English Name (2-Methylbenzyl)(triphenyl)phosphonium chloride
Molecular Formula C26H24ClP
Molecular Weight 402.9 g/mol
SMILES CC1=CC=CC=C1C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
InChIKey RDHRQYBAQXBTNT-UHFFFAOYSA-M
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5) typically synthesized?

(2-Methylbenzyl)(triphenyl)phosphonium chloride is typically synthesized by reacting 2-methylbenzyl ...

Compound Q&A

What industries use (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5)?

(2-Methylbenzyl)(triphenyl)phosphonium chloride finds application in pharmaceuticals for the synthes...

Compound Q&A

What precautions should be taken when handling (2-Methylbenzyl)(triphenyl)phosphonium chloride (CAS: 63368-36-5)?

When handling (2-Methylbenzyl)(triphenyl)phosphonium chloride, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...