Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-chloro-3-methoxybenzoate (CAS: 697762-67-7)?

Answer

Methyl 5-bromo-2-chloro-3-methoxybenzoate
Methyl 5-bromo-2-chloro-3-methoxybenzoate is a crystalline solid with a molecular weight of approximately 321.04 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It has a melting point around 80-82°C.

About

English Name Methyl 5-bromo-2-chloro-3-methoxybenzoate
Molecular Formula C9H8BrClO3
Molecular Weight 279.52 g/mol
SMILES COC(=O)c1cc(Br)cc(c1Cl)OC
InChIKey IEMDCTKBMXAVHF-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is Methyl 5-bromo-2-chloro-3-methoxybenzoate (CAS: 697762-67-7) typically synthesized?

Methyl 5-bromo-2-chloro-3-methoxybenzoate is commonly synthesized through a series of reactions star...

Compound Q&A

What industries use Methyl 5-bromo-2-chloro-3-methoxybenzoate (CAS: 697762-67-7)?

Methyl 5-bromo-2-chloro-3-methoxybenzoate is primarily used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-chloro-3-methoxybenzoate (CAS: 697762-67-7)?

When handling Methyl 5-bromo-2-chloro-3-methoxybenzoate, it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...