Compound Q&A

What industries use Amylin (8-37) (human) (CAS: 135702-23-7)?

Answer

Amylin (8-37) (human)
Amylin (8-37) (human) (CAS: 135702-23-7) is primarily used in the pharmaceutical industry for research and development of diabetes treatments. It is also utilized in the biotechnology sector for peptide-based drug discovery and in academic and industrial laboratories for its structural and functional studies. Its applications in polymers and sensors are limited due to its biological nature.

About

English Name Amylin (8-37) (human)
Molecular Formula C138H216N42O45
Molecular Weight 3183.4 g/mol
SMILES CCC(C)C(C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(CC(=O)N)C(=O)NC(C(C)C)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N)NC(=O)C(C)NC(=O)CNC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)N)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(CC3=CNC=N3)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC4=CC=CC=C4)NC(=O)C(CC(=O)N)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)N)NC(=O)C(C(C)O)NC(=O)C(C)N
InChIKey OBFZUAVBRVNJDZ-AWNVCVQVSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amylin (8-37) (human) (CAS: 135702-23-7)?

Amylin (8-37) (human) (CAS: 135702-23-7) is a polypeptide with a molecular weight of approximately 1...

Compound Q&A

How is Amylin (8-37) (human) (CAS: 135702-23-7) typically synthesized?

Amylin (8-37) (human) (CAS: 135702-23-7) is synthesized through solid-phase peptide synthesis (SPPS)...

Compound Q&A

What precautions should be taken when handling Amylin (8-37) (human) (CAS: 135702-23-7)?

When handling Amylin (8-37) (human) (CAS: 135702-23-7), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...