Compound Q&A

How is Amylin (8-37) (human) (CAS: 135702-23-7) typically synthesized?

Answer

Amylin (8-37) (human)
Amylin (8-37) (human) (CAS: 135702-23-7) is synthesized through solid-phase peptide synthesis (SPPS). The process involves sequential coupling of amino acids, using Fmoc chemistry and HBTU coupling reagent. The peptide is then cleaved from the resin using trifluoroacetic acid (TFA) and subsequent purification is achieved through HPLC. The synthesis typically yields a purity of over 95%, with excellent regioselectivity and good yield.

About

English Name Amylin (8-37) (human)
Molecular Formula C138H216N42O45
Molecular Weight 3183.4 g/mol
SMILES CCC(C)C(C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(CC(=O)N)C(=O)NC(C(C)C)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N)NC(=O)C(C)NC(=O)CNC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)N)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(CC3=CNC=N3)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC4=CC=CC=C4)NC(=O)C(CC(=O)N)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)N)NC(=O)C(C(C)O)NC(=O)C(C)N
InChIKey OBFZUAVBRVNJDZ-AWNVCVQVSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amylin (8-37) (human) (CAS: 135702-23-7)?

Amylin (8-37) (human) (CAS: 135702-23-7) is a polypeptide with a molecular weight of approximately 1...

Compound Q&A

What industries use Amylin (8-37) (human) (CAS: 135702-23-7)?

Amylin (8-37) (human) (CAS: 135702-23-7) is primarily used in the pharmaceutical industry for resear...

Compound Q&A

What precautions should be taken when handling Amylin (8-37) (human) (CAS: 135702-23-7)?

When handling Amylin (8-37) (human) (CAS: 135702-23-7), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...