Compound Q&A

What industries use 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8)?

Answer

4-Chloro-2-fluorobenzoyl chloride
4-Chloro-2-fluorobenzoyl chloride is used primarily in the pharmaceutical industry for the synthesis of various drug intermediates. It is also employed in the polymer industry for modifying polymers and in the electronics industry for use in semiconductor materials and sensors due to its functional groups that can participate in chemical reactions.

About

CAS No 394-39-8
English Name 4-Chloro-2-fluorobenzoyl chloride
Molecular Formula C7H3Cl2FO
Molecular Weight 193 g/mol
SMILES C1=CC(=C(C=C1Cl)F)C(=O)Cl
InChIKey PWHFJLCMUCFYRQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8)?

4-Chloro-2-fluorobenzoyl chloride is a white to off-white crystalline solid with a molecular weight ...

Compound Q&A

How is 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8) typically synthesized?

4-Chloro-2-fluorobenzoyl chloride is typically synthesized by chlorination of 2-fluorobenzoyl chlori...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8)?

Handling 4-Chloro-2-fluorobenzoyl chloride requires strict safety measures. It should be conducted i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...