Compound Q&A

How is 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8) typically synthesized?

Answer

4-Chloro-2-fluorobenzoyl chloride
4-Chloro-2-fluorobenzoyl chloride is typically synthesized by chlorination of 2-fluorobenzoyl chloride with chlorine gas in the presence of a Lewis acid catalyst such as aluminum chloride. The reaction is conducted in a suitable organic solvent, and the yield can be improved by optimizing the reaction conditions and using appropriate catalysts.

About

CAS No 394-39-8
English Name 4-Chloro-2-fluorobenzoyl chloride
Molecular Formula C7H3Cl2FO
Molecular Weight 193 g/mol
SMILES C1=CC(=C(C=C1Cl)F)C(=O)Cl
InChIKey PWHFJLCMUCFYRQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8)?

4-Chloro-2-fluorobenzoyl chloride is a white to off-white crystalline solid with a molecular weight ...

Compound Q&A

What industries use 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8)?

4-Chloro-2-fluorobenzoyl chloride is used primarily in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-fluorobenzoyl chloride (CAS: 394-39-8)?

Handling 4-Chloro-2-fluorobenzoyl chloride requires strict safety measures. It should be conducted i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...