Compound Q&A

What industries use 2-Phenoxynicotinic acid (CAS: 35620-71-4)?

Answer

2-Phenoxynicotinic acid
2-Phenoxynicotinic acid is used primarily in the pharmaceutical industry as an intermediate in the synthesis of various organic compounds. It is also utilized in the production of dyes and pigments. Additionally, it has applications in the manufacturing of some types of sensors and as a component in some polymer formulations.

About

CAS No 35620-71-4
English Name 2-Phenoxynicotinic acid
Molecular Formula C12H9NO3
Molecular Weight 215.21 g/mol
SMILES C1=CC=C(C=C1)OC2=C(C=CC=N2)C(=O)O
InChIKey CQGAXJGXGLVFGJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Phenoxynicotinic acid (CAS: 35620-71-4)?

2-Phenoxynicotinic acid is a white crystalline solid with a molecular weight of 226.24 g/mol. It has...

Compound Q&A

How is 2-Phenoxynicotinic acid (CAS: 35620-71-4) typically synthesized?

2-Phenoxynicotinic acid is typically synthesized by the condensation of 2-chloronicotinic acid and p...

Compound Q&A

What precautions should be taken when handling 2-Phenoxynicotinic acid (CAS: 35620-71-4)?

When handling 2-Phenoxynicotinic acid, it is important to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...