Compound Q&A

What industries use 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0)?

Answer

3-(1H-pyrazol-3-yl)benzoic acid
3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0) finds applications in the pharmaceutical industry for its potential as a drug intermediate. It is also used in the production of sensors and as a precursor in the synthesis of other compounds. Its properties make it suitable for research and development in materials science, particularly in the area of semiconductors and polymers.

About

English Name 3-(1H-pyrazol-3-yl)benzoic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.19 g/mol
SMILES OC(=O)c1cccc(c1)c2cc[nH]n2
InChIKey RXZRBZWATRFHCS-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0)?

3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0) typically synthesized?

3-(1H-pyrazol-3-yl)benzoic acid can be synthesized via several routes. A common method involves the ...

Compound Q&A

What precautions should be taken when handling 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0)?

When handling 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0), it is important to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...