Compound Q&A

What are the physical and chemical properties of 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0)?

Answer

3-(1H-pyrazol-3-yl)benzoic acid
3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0) is a crystalline solid with a molecular weight of approximately 226.2 g/mol. It has a pKa of about 4.6 and is slightly soluble in water but soluble in organic solvents like ethanol and acetonitrile. Chemically, it exhibits typical carboxylic acid reactivity, including esterification and formation of salts.

About

English Name 3-(1H-pyrazol-3-yl)benzoic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.19 g/mol
SMILES OC(=O)c1cccc(c1)c2cc[nH]n2
InChIKey RXZRBZWATRFHCS-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0) typically synthesized?

3-(1H-pyrazol-3-yl)benzoic acid can be synthesized via several routes. A common method involves the ...

Compound Q&A

What industries use 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0)?

3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0) finds applications in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0)?

When handling 3-(1H-pyrazol-3-yl)benzoic acid (CAS: 850375-11-0), it is important to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...