Compound Q&A

What precautions should be taken when handling 2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3)?

Answer

2-Phenyl-4(1H)-quinazolinone
When handling 2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents. Always consult a safety data sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 1022-45-3
English Name 2-Phenyl-4(1H)-quinazolinone
Molecular Formula C14H10N2O
Molecular Weight 222.25 g/mol
SMILES C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=O)N2
InChIKey VDULOAUXSMYUMG-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3)?

2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3) is a crystalline compound with a molecular weight of a...

Compound Q&A

How is 2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3) typically synthesized?

2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3) can be synthesized by the condensation of 2-aminopheny...

Compound Q&A

What industries use 2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3)?

2-Phenyl-4(1H)-quinazolinone (CAS: 1022-45-3) is used in the pharmaceutical industry for the develop...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...