Compound Q&A

What are the physical and chemical properties of Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6)?

Answer

Tert-butyl 4,4-difluoropiperidine-1-carboxylate
Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6) is a crystalline solid with a molecular weight of approximately 249.23 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and dichloromethane. This compound is known for its reactivity, particularly in nucleophilic substitution and condensation reactions.

About

English Name Tert-butyl 4,4-difluoropiperidine-1-carboxylate
Molecular Formula C10H17F2NO2
Molecular Weight 221.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)(F)F
InChIKey HHBBBPZPEBZLII-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6) typically synthesized?

Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6) is typically synthesized via the ...

Compound Q&A

What industries use Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6)?

Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4,4-difluoropiperidine-1-carboxylate (CAS: 281652-10-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be used wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...