Compound Q&A

What precautions should be taken when handling 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1)?

Answer

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid
When handling 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1), operators should wear appropriate personal protective equipment (PPE), including gloves, lab coat, and safety goggles. Storage should be in a cool, dry place away from heat sources. In case of spill, immediately neutralize with an appropriate acid-base buffer to minimize environmental impact. Refer to the Safety Data Sheet (SDS) for detailed handling procedures.

About

English Name 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CCC(=O)O
InChIKey ZVYVZEUADCRFHK-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1)?

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) is a white...

Compound Q&A

How is 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) typically synthesized?

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) is typical...

Compound Q&A

What industries use 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1)?

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) is primari...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...