Compound Q&A

What are the physical and chemical properties of 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1)?

Answer

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid
3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) is a white to off-white crystalline solid with a molecular weight of approximately 334.4 g/mol. It has poor water solubility and good solubility in organic solvents like methanol and ethyl acetate. The compound is moderately reactive, showing susceptibility to hydrolysis under basic conditions. It is stable under neutral and acidic conditions.

About

English Name 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CCC(=O)O
InChIKey ZVYVZEUADCRFHK-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) typically synthesized?

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) is typical...

Compound Q&A

What industries use 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1)?

3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1) is primari...

Compound Q&A

What precautions should be taken when handling 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58-1)?

When handling 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid (CAS: 352004-58...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...