Compound Q&A

How is (4-Fluorophenyl)(4-piperidinyl)methanone (CAS: 56346-57-7) typically synthesized?

Answer

(4-Fluorophenyl)(4-piperidinyl)methanone
(4-Fluorophenyl)(4-piperidinyl)methanone is synthesized via a multi-step process, often involving the reaction of 4-fluoroaniline with piperidine in the presence of a suitable base such as sodium hydroxide. The yield is typically around 80-90%, and the selectivity for the desired product is high. The final step involves methylation using methyl iodide and a base like potassium carbonate.

About

CAS No 56346-57-7
English Name (4-Fluorophenyl)(4-piperidinyl)methanone
Molecular Formula C12H14FNO
Molecular Weight 207.25 g/mol
SMILES C1CNCCC1C(=O)C2=CC=C(C=C2)F
InChIKey ABERUOJGWHYBJL-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Fluorophenyl)(4-piperidinyl)methanone (CAS: 56346-57-7)?

(4-Fluorophenyl)(4-piperidinyl)methanone is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use (4-Fluorophenyl)(4-piperidinyl)methanone (CAS: 56346-57-7)?

(4-Fluorophenyl)(4-piperidinyl)methanone is used in the pharmaceutical industry as a precursor for t...

Compound Q&A

What precautions should be taken when handling (4-Fluorophenyl)(4-piperidinyl)methanone (CAS: 56346-57-7)?

When handling (4-Fluorophenyl)(4-piperidinyl)methanone, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...