Compound Q&A

What precautions should be taken when handling 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4)?

Answer

2,5-Bis(trifluoromethyl)phenol
When handling 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4), use appropriate personal protective equipment such as gloves, safety goggles, and a lab coat. Store it in a well-ventilated area away from heat sources and reduce the risk of inhalation by working under a fume hood. In case of a spill, immediately clean with a suitable solvent and consult a Material Safety Data Sheet (MSDS) for detailed instructions.

About

CAS No 779-88-4
English Name 2,5-Bis(trifluoromethyl)phenol
Molecular Formula C8H4F6O
Molecular Weight 230.11 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)O)C(F)(F)F
InChIKey OJOPQGWFLQVKDU-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4)?

2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4) is a colorless crystalline solid with a molecular wei...

Compound Q&A

How is 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4) typically synthesized?

2,5-Bis(trifluoromethyl)phenol can be synthesized via the reaction of 2,5-dichlorophenol with potass...

Compound Q&A

What industries use 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4)?

2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4) is used in various industries, including pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...