Compound Q&A

What are the physical and chemical properties of 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4)?

Answer

2,5-Bis(trifluoromethyl)phenol
2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4) is a colorless crystalline solid with a molecular weight of approximately 224.14 g/mol. It has low water solubility but good solubility in organic solvents such as acetone and methanol. Chemically, it is relatively stable but can react with strong bases to form trifluoromethyl phenol salts. It has high reactivity towards nucleophiles and can be used as a precursor in various organic syntheses.

About

CAS No 779-88-4
English Name 2,5-Bis(trifluoromethyl)phenol
Molecular Formula C8H4F6O
Molecular Weight 230.11 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)O)C(F)(F)F
InChIKey OJOPQGWFLQVKDU-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4) typically synthesized?

2,5-Bis(trifluoromethyl)phenol can be synthesized via the reaction of 2,5-dichlorophenol with potass...

Compound Q&A

What industries use 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4)?

2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4)?

When handling 2,5-Bis(trifluoromethyl)phenol (CAS: 779-88-4), use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...