Compound Q&A

What are the physical and chemical properties of 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide (CAS: 299166-55-5)?

Answer

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide
1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide is a crystalline compound with a molecular weight of approximately 274.24 g/mol. It has limited water solubility and moderate solubility in common organic solvents. The compound exhibits some reactivity towards acid and base conditions. It crystallizes in the monoclinic system and has a melting point around 190-192°C.

About

English Name 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide
Molecular Formula C7H10N4O
Molecular Weight 166.18 g/mol
SMILES [NH]1C2=C(C(=N1)C(=O)NN)CCC2
InChIKey SVCCSHLJCQVHGW-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide (CAS: 299166-55-5) typically synthesized?

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide can be synthesized via the condensation of ...

Compound Q&A

What industries use 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide (CAS: 299166-55-5)?

1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide (CAS: 299166-55-5) in a laboratory setting?

When handling 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbohydrazide, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...