Compound Q&A

What industries use 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3)?

Answer

2-Bromo-4-(2-methyl-2-propanyl)benzoic acid
2-Bromo-4-(2-methyl-2-propanyl)benzoic acid finds applications in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also used in the polymer industry as a monomer or intermediate. Additionally, it has applications in the production of sensors and semiconductors, where its specific chemical properties make it suitable for functionalization and modification.

About

CAS No 6332-96-3
English Name 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid
Molecular Formula C11H13BrO2
Molecular Weight 257.13 g/mol
SMILES CC(C)(C)C1=CC(Br)=C(C=C1)C(O)=O
InChIKey ZLTIYXKXOZKGDG-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3)?

2-Bromo-4-(2-methyl-2-propanyl)benzoic acid is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3) typically synthesized?

2-Bromo-4-(2-methyl-2-propanyl)benzoic acid is typically synthesized via a multi-step process starti...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3)?

When handling 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...