Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3)?

Answer

2-Bromo-4-(2-methyl-2-propanyl)benzoic acid
2-Bromo-4-(2-methyl-2-propanyl)benzoic acid is a white crystalline solid with a molecular weight of approximately 256.04 g/mol. It has a low solubility in water (less than 1 g/L at 20°C) and is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with bases to form the corresponding sodium salt. It is not highly reactive under normal conditions but should be handled with care due to its halogen content.

About

CAS No 6332-96-3
English Name 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid
Molecular Formula C11H13BrO2
Molecular Weight 257.13 g/mol
SMILES CC(C)(C)C1=CC(Br)=C(C=C1)C(O)=O
InChIKey ZLTIYXKXOZKGDG-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3) typically synthesized?

2-Bromo-4-(2-methyl-2-propanyl)benzoic acid is typically synthesized via a multi-step process starti...

Compound Q&A

What industries use 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3)?

2-Bromo-4-(2-methyl-2-propanyl)benzoic acid finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid (CAS: 6332-96-3)?

When handling 2-Bromo-4-(2-methyl-2-propanyl)benzoic acid, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...