Compound Q&A

What are the physical and chemical properties of 2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone (CAS: 120013-84-5)?

Answer

2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone
2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone is a white crystalline solid with a molecular weight of approximately 428.38 g/mol. It is slightly soluble in water and exhibits good solubility in common organic solvents like methanol and ethanol. This compound is known for its reactivity, particularly in esterification and amidation reactions due to the presence of methoxy groups and amide functionality. It shows significant hydrophobicity and is stable under normal conditions, but care should be taken when exposed to strong acids or bases.

About

English Name 2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone
Molecular Formula C24H29NO4
Molecular Weight 395.5 g/mol
SMILES COC1=C(C=C2C(=C1)CC(C2=O)CC3CC[N+](CC3)(CC4=CC=CC=C4)[O-])OC
InChIKey XRPRYHONRUINMG-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone (CAS: 120013-84-5) typically synthesized?

2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone is typically synthesized via a m...

Compound Q&A

What industries use 2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone (CAS: 120013-84-5)?

2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone is utilized in various industrie...

Compound Q&A

What precautions should be taken when handling 2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone (CAS: 120013-84-5)?

Handling 2-[(1-Benzyl-1-oxido-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone requires appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...