Compound Q&A

What precautions should be taken when handling 5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1)?

Answer

5-Bromo-8-methoxy-2-methylquinoline
When handling 5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or within a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbents, and the area should be washed down. Always refer to the Safety Data Sheet (SDS) for specific handling and emergency procedures.

About

English Name 5-Bromo-8-methoxy-2-methylquinoline
Molecular Formula C11H10BrNO
Molecular Weight 252.11 g/mol
SMILES CC1=NC2=C(C=CC(=C2C=C1)Br)OC
InChIKey MCBRCJBMVOOJFX-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1)?

5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1) typically synthesized?

5-Bromo-8-methoxy-2-methylquinoline is typically synthesized through a multistep process involving a...

Compound Q&A

What industries use 5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1)?

5-Bromo-8-methoxy-2-methylquinoline (CAS: 103862-55-1) finds applications in the pharmaceutical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...