Compound Q&A

What industries use 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4)?

Answer

6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid
6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid finds applications in the pharmaceutical industry for the development of certain therapeutic agents. It is also used in the production of fluorescent dyes and sensors due to its photophysical properties. Additionally, it may have potential uses in the synthesis of novel materials and in the development of organic semiconductors.

About

CAS No 33458-93-4
English Name 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid
Molecular Formula C17H14O5
Molecular Weight 298.29 g/mol
SMILES CC(C)OC1=CC2=C(C=C1)C(=O)C3=C(O2)C=CC(=C3)C(=O)O
InChIKey AQFFXPQJLZFABJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4)?

6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid is a white crystalline solid with a molecular weigh...

Compound Q&A

How is 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4) typically synthesized?

6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid is typically synthesized through a multistep proces...

Compound Q&A

What precautions should be taken when handling 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4)?

When handling 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid, it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...