Compound Q&A

What are the physical and chemical properties of 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4)?

Answer

6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid
6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid is a white crystalline solid with a molecular weight of approximately 317.36 g/mol. It has a low water solubility and is soluble in organic solvents such as dichloromethane and acetone. The compound is relatively stable but can react with strong bases. It has a melting point of around 210°C and a pKa of approximately 2.5.

About

CAS No 33458-93-4
English Name 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid
Molecular Formula C17H14O5
Molecular Weight 298.29 g/mol
SMILES CC(C)OC1=CC2=C(C=C1)C(=O)C3=C(O2)C=CC(=C3)C(=O)O
InChIKey AQFFXPQJLZFABJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4) typically synthesized?

6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid is typically synthesized through a multistep proces...

Compound Q&A

What industries use 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4)?

6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid finds applications in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid (CAS: 33458-93-4)?

When handling 6-Isopropoxy-9-oxo-9H-xanthene-2-carboxylic acid, it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...