Compound Q&A

What industries use 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1)?

Answer

6-Oxocevan-2-yl hexopyranoside
6-Oxocevan-2-yl hexopyranoside finds applications in the pharmaceutical industry, particularly in the synthesis of complex natural products and biologically active compounds. It is also utilized in polymer chemistry for the development of functional materials and in sensor technology for the detection of specific analytes.

About

CAS No 98985-24-1
English Name 6-Oxocevan-2-yl hexopyranoside
Molecular Formula C33H53NO7
Molecular Weight 575.78 g/mol
SMILES CC1CCC2C(C3CCC4C(C3CN2C1)CC5C4CC(=O)C6C5(CC(CC6)OC7C(C(C(C(O7)CO)O)O)O)C)C
InChIKey KZQBVJMJOSOUQU-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1)?

6-Oxocevan-2-yl hexopyranoside is a crystalline compound with a molecular weight of approximately 39...

Compound Q&A

How is 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1) typically synthesized?

6-Oxocevan-2-yl hexopyranoside is synthesized via a multi-step process involving the condensation of...

Compound Q&A

What precautions should be taken when handling 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1)?

When handling 6-Oxocevan-2-yl hexopyranoside, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...