Compound Q&A

How is 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1) typically synthesized?

Answer

6-Oxocevan-2-yl hexopyranoside
6-Oxocevan-2-yl hexopyranoside is synthesized via a multi-step process involving the condensation of an oxocyclohexanone derivative with a hexopyranoside in the presence of a catalyst such as a Lewis acid or a metal complex. The reaction is typically carried out in the presence of an organic solvent like dichloromethane. The yield can vary, but selectivity for the desired product is high.

About

CAS No 98985-24-1
English Name 6-Oxocevan-2-yl hexopyranoside
Molecular Formula C33H53NO7
Molecular Weight 575.78 g/mol
SMILES CC1CCC2C(C3CCC4C(C3CN2C1)CC5C4CC(=O)C6C5(CC(CC6)OC7C(C(C(C(O7)CO)O)O)O)C)C
InChIKey KZQBVJMJOSOUQU-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1)?

6-Oxocevan-2-yl hexopyranoside is a crystalline compound with a molecular weight of approximately 39...

Compound Q&A

What industries use 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1)?

6-Oxocevan-2-yl hexopyranoside finds applications in the pharmaceutical industry, particularly in th...

Compound Q&A

What precautions should be taken when handling 6-Oxocevan-2-yl hexopyranoside (CAS: 98985-24-1)?

When handling 6-Oxocevan-2-yl hexopyranoside, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...