Compound Q&A

What industries use Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5)?

Answer

Chitotetraose tetrahydrochloride hydrate
Chitotetraose tetrahydrochloride hydrate is used in various industries, including pharmaceuticals for its potential as a bioactive compound, in the production of polymers for its structural properties, and in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name Chitotetraose tetrahydrochloride hydrate
Molecular Formula C24H47ClN4O17
Molecular Weight 699.1 g/mol
SMILES OC[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O)O.Cl
InChIKey TWEYQBIEOMWMHH-GEKXSUFZSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5)?

Chitotetraose tetrahydrochloride hydrate is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5) typically synthesized?

Chitotetraose tetrahydrochloride hydrate is typically synthesized through the hydrolysis of chitin, ...

Compound Q&A

What precautions should be taken when handling Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5)?

When handling Chitotetraose tetrahydrochloride hydrate, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...