Compound Q&A

How is Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5) typically synthesized?

Answer

Chitotetraose tetrahydrochloride hydrate
Chitotetraose tetrahydrochloride hydrate is typically synthesized through the hydrolysis of chitin, followed by the reaction with hydrochloric acid. The process involves the use of strong acids and bases, with yield and selectivity varying based on reaction conditions. The exact method may involve the use of catalysts to enhance reaction selectivity and yield.

About

English Name Chitotetraose tetrahydrochloride hydrate
Molecular Formula C24H47ClN4O17
Molecular Weight 699.1 g/mol
SMILES OC[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O)O.Cl
InChIKey TWEYQBIEOMWMHH-GEKXSUFZSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5)?

Chitotetraose tetrahydrochloride hydrate is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5)?

Chitotetraose tetrahydrochloride hydrate is used in various industries, including pharmaceuticals fo...

Compound Q&A

What precautions should be taken when handling Chitotetraose tetrahydrochloride hydrate (CAS: 117399-50-5)?

When handling Chitotetraose tetrahydrochloride hydrate, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...