Compound Q&A

What industries use (+)-Nortrachelogenin (CAS: 61521-74-2)?

Answer

(+)-Nortrachelogenin
(+)-Nortrachelogenin is primarily used in the pharmaceutical industry for its potential as a natural product lead for drug development. It is also of interest in the chemical and polymer industry for its structural properties, though its specific applications in these areas are limited. It may also find use in sensor technology due to its unique chemical characteristics.

About

CAS No 61521-74-2
English Name (+)-Nortrachelogenin
Molecular Formula C20H22O7
Molecular Weight 374.39 g/mol
SMILES COC1=C(C=CC(=C1)CC2COC(=O)C2(CC3=CC(=C(C=C3)O)OC)O)O
InChIKey ZITBJWXLODLDRH-JLTOFOAXSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-Nortrachelogenin (CAS: 61521-74-2)?

The physical form of (+)-Nortrachelogenin is a white crystalline powder. It has a molecular weight o...

Compound Q&A

How is (+)-Nortrachelogenin (CAS: 61521-74-2) typically synthesized?

(+)-Nortrachelogenin can be synthesized through a series of stereo-selective reactions, including a ...

Compound Q&A

What precautions should be taken when handling (+)-Nortrachelogenin (CAS: 61521-74-2)?

When handling (+)-Nortrachelogenin, appropriate personal protective equipment (PPE) such as gloves a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...