Compound Q&A

What are the physical and chemical properties of (+)-Nortrachelogenin (CAS: 61521-74-2)?

Answer

(+)-Nortrachelogenin
The physical form of (+)-Nortrachelogenin is a white crystalline powder. It has a molecular weight of 362.35 g/mol. This compound is moderately soluble in ethanol and acetone but insoluble in water. Chemically, it is stable at room temperature but can be reactive with strong acids or bases. It does not typically undergo spontaneous decomposition under normal laboratory conditions.

About

CAS No 61521-74-2
English Name (+)-Nortrachelogenin
Molecular Formula C20H22O7
Molecular Weight 374.39 g/mol
SMILES COC1=C(C=CC(=C1)CC2COC(=O)C2(CC3=CC(=C(C=C3)O)OC)O)O
InChIKey ZITBJWXLODLDRH-JLTOFOAXSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is (+)-Nortrachelogenin (CAS: 61521-74-2) typically synthesized?

(+)-Nortrachelogenin can be synthesized through a series of stereo-selective reactions, including a ...

Compound Q&A

What industries use (+)-Nortrachelogenin (CAS: 61521-74-2)?

(+)-Nortrachelogenin is primarily used in the pharmaceutical industry for its potential as a natural...

Compound Q&A

What precautions should be taken when handling (+)-Nortrachelogenin (CAS: 61521-74-2)?

When handling (+)-Nortrachelogenin, appropriate personal protective equipment (PPE) such as gloves a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...