Compound Q&A

How is Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0) typically synthesized?

Answer

Methyl 2-(bromomethyl)-3-methoxybenzoate
Methyl 2-(bromomethyl)-3-methoxybenzoate can be synthesized through the bromination of 3-methoxybenzyl alcohol followed by esterification with methyl alcohol. The reaction typically involves using N-bromosuccinimide (NBS) as the brominating agent, with benzoyl peroxide as a co-initiator, and is carried out under UV light or heat. The yield of the reaction is generally high, and the product is purified by recrystallization.

About

CAS No 71887-28-0
English Name Methyl 2-(bromomethyl)-3-methoxybenzoate
Molecular Formula C10H11BrO3
Molecular Weight 259.1 g/mol
SMILES COC1=CC=CC(=C1CBr)C(=O)OC
InChIKey HYLGKOGJOVGRNN-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0)?

Methyl 2-(bromomethyl)-3-methoxybenzoate is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0)?

Methyl 2-(bromomethyl)-3-methoxybenzoate is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0)?

When handling Methyl 2-(bromomethyl)-3-methoxybenzoate, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...