Compound Q&A

What are the physical and chemical properties of Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0)?

Answer

Methyl 2-(bromomethyl)-3-methoxybenzoate
Methyl 2-(bromomethyl)-3-methoxybenzoate is a white crystalline solid with a molecular weight of approximately 313.02 g/mol. It has poor water solubility but is soluble in organic solvents such as methanol and ethanol. This compound is relatively stable but can react with nucleophiles at the bromomethyl group. It is used in various synthesis routes and is known for its reactivity in organic transformations.

About

CAS No 71887-28-0
English Name Methyl 2-(bromomethyl)-3-methoxybenzoate
Molecular Formula C10H11BrO3
Molecular Weight 259.1 g/mol
SMILES COC1=CC=CC(=C1CBr)C(=O)OC
InChIKey HYLGKOGJOVGRNN-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0) typically synthesized?

Methyl 2-(bromomethyl)-3-methoxybenzoate can be synthesized through the bromination of 3-methoxybenz...

Compound Q&A

What industries use Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0)?

Methyl 2-(bromomethyl)-3-methoxybenzoate is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling Methyl 2-(bromomethyl)-3-methoxybenzoate (CAS: 71887-28-0)?

When handling Methyl 2-(bromomethyl)-3-methoxybenzoate, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...