Compound Q&A

What precautions should be taken when handling (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0)?

Answer

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid
When handling (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up using absorbent materials, followed by rinsing with water. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])C(CC(=O)O)N
InChIKey SJBFILRQMRECCK-MRVPVSSYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0)?

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid is a white crystalline solid with a molecular weight of...

Compound Q&A

How is (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0) typically synthesized?

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid can be synthesized via a multi-step process involving n...

Compound Q&A

What industries use (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0)?

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid is primarily used in pharmaceuticals for the developmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...