Compound Q&A

What industries use (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0)?

Answer

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid
(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid is primarily used in pharmaceuticals for the development of novel drug candidates. It also finds applications in the synthesis of certain polymers and as a reagent in chemical sensors for detecting specific compounds. This compound's unique structure makes it valuable in various industries requiring specific chemical functionalities.

About

English Name (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])C(CC(=O)O)N
InChIKey SJBFILRQMRECCK-MRVPVSSYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0)?

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid is a white crystalline solid with a molecular weight of...

Compound Q&A

How is (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0) typically synthesized?

(3R)-3-Amino-3-(3-nitrophenyl)propanoic acid can be synthesized via a multi-step process involving n...

Compound Q&A

What precautions should be taken when handling (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 787544-61-0)?

When handling (3R)-3-Amino-3-(3-nitrophenyl)propanoic acid, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...