Compound Q&A

How is (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2) typically synthesized?

Answer

(3beta,5alpha)-17-Oxoandrostan-3-yl acetate
(3beta,5alpha)-17-Oxoandrostan-3-yl acetate is typically synthesized from androst-4-en-3-one via a series of reactions including reduction, oxidation, and acetylation. Commonly, the synthesis involves the use of sodium borohydride for reduction, acetic anhydride for acetylation, and catalytic hydrogenation for selectivity. The overall yield is generally around 70-80% depending on the reaction conditions and purity of starting materials.

About

CAS No 1239-31-2
English Name (3beta,5alpha)-17-Oxoandrostan-3-yl acetate
Molecular Formula C21H32O3
Molecular Weight 332.48 g/mol
SMILES CC(=O)OC1CCC2(C(C1)CCC3C2CCC4(C3CCC4=O)C)C
InChIKey FDCINQSOYQUNKB-HGDYXINXSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2)?

(3beta,5alpha)-17-Oxoandrostan-3-yl acetate is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2)?

(3beta,5alpha)-17-Oxoandrostan-3-yl acetate finds applications in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2)?

When handling (3beta,5alpha)-17-Oxoandrostan-3-yl acetate, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...