Compound Q&A

What are the physical and chemical properties of (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2)?

Answer

(3beta,5alpha)-17-Oxoandrostan-3-yl acetate
(3beta,5alpha)-17-Oxoandrostan-3-yl acetate is a white crystalline solid with a molecular weight of approximately 322.45 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. The compound exhibits moderate reactivity, particularly towards ester hydrolysis under basic conditions. It also shows some instability towards heat and light, which should be considered during storage and handling.

About

CAS No 1239-31-2
English Name (3beta,5alpha)-17-Oxoandrostan-3-yl acetate
Molecular Formula C21H32O3
Molecular Weight 332.48 g/mol
SMILES CC(=O)OC1CCC2(C(C1)CCC3C2CCC4(C3CCC4=O)C)C
InChIKey FDCINQSOYQUNKB-HGDYXINXSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2) typically synthesized?

(3beta,5alpha)-17-Oxoandrostan-3-yl acetate is typically synthesized from androst-4-en-3-one via a s...

Compound Q&A

What industries use (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2)?

(3beta,5alpha)-17-Oxoandrostan-3-yl acetate finds applications in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling (3beta,5alpha)-17-Oxoandrostan-3-yl acetate (CAS: 1239-31-2)?

When handling (3beta,5alpha)-17-Oxoandrostan-3-yl acetate, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...