Compound Q&A

What industries use Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2)?

Answer

Benzoic acid, 4-(2-phenyldiazenyl)-
Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in polymer production, where its diazenyl group can be used for functionalization. Additionally, it is employed in the development of sensors and semiconductors, leveraging its unique chemical structure.

About

CAS No 1562-93-2
English Name Benzoic acid, 4-(2-phenyldiazenyl)-
Molecular Formula C13H10N2O2
Molecular Weight 226.23 g/mol
SMILES C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O
InChIKey CSPTZWQFHBVOLO-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2)?

Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2) is a solid with a crystalline form at room tempe...

Compound Q&A

How is Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2) typically synthesized?

Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2) can be synthesized via diazotization of a substi...

Compound Q&A

What precautions should be taken when handling Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2)?

When handling Benzoic acid, 4-(2-phenyldiazenyl) (CAS: 1562-93-2), ensure proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...