Compound Q&A

What precautions should be taken when handling (3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7)?

Answer

(3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate
When handling (3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7), it is crucial to follow standard safety protocols. Wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work in a well-ventilated area, preferably in a fume hood, to minimize exposure to the compound and its vapors. Ensure proper storage in a cool, dry place away from sources of heat and moisture. Spills should be cleaned up using appropriate methods, and always consult the safety data sheet (SDS) for detailed instructions and emergency procedures.

About

CAS No 7392-74-7
English Name (3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate
Molecular Formula C27H22O8
Molecular Weight 474.47 g/mol
SMILES CC1(C(C(OC1=O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4
InChIKey KOELERLPRQKGLG-VHFRWLAGSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7)?

(3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7)...

Compound Q&A

How is (3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7) typically synthesized?

(3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7)...

Compound Q&A

What industries use (3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7)?

(3R,4R,5R)-5-[(Benzoyloxy)methyl]-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate (CAS: 7392-74-7)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...