Compound Q&A

What precautions should be taken when handling Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9)?

Answer

Ethyl 7-nitro-1H-indole-2-carboxylate
When handling Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Handling should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate cleaning agents. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 6960-46-9
English Name Ethyl 7-nitro-1H-indole-2-carboxylate
Molecular Formula C11H10N2O4
Molecular Weight 234.21 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C(=CC=C2)[N+](=O)[O-]
InChIKey GTZAIVBXGPLYGD-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9)?

Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) is a crystalline solid with a molecular weigh...

Compound Q&A

How is Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) typically synthesized?

Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) is typically synthesized via a condensation r...

Compound Q&A

What industries use Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9)?

Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) is primarily used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...