Compound Q&A

What are the physical and chemical properties of Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9)?

Answer

Ethyl 7-nitro-1H-indole-2-carboxylate
Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) is a crystalline solid with a molecular weight of approximately 263.15 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. This compound is known for its moderate reactivity, particularly in nucleophilic substitution and elimination reactions. It has a high melting point and is stable under normal laboratory conditions.

About

CAS No 6960-46-9
English Name Ethyl 7-nitro-1H-indole-2-carboxylate
Molecular Formula C11H10N2O4
Molecular Weight 234.21 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C(=CC=C2)[N+](=O)[O-]
InChIKey GTZAIVBXGPLYGD-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) typically synthesized?

Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) is typically synthesized via a condensation r...

Compound Q&A

What industries use Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9)?

Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9)?

When handling Ethyl 7-nitro-1H-indole-2-carboxylate (CAS: 6960-46-9), appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...