Compound Q&A

How is 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0) typically synthesized?

Answer

2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is typically synthesized via a multi-step process involving the reaction of 2-methyl-2-propanol with phosgene followed by the amidation of the resulting intermediate with an appropriate amine. The reaction is carried out under anhydrous conditions to ensure high yield and selectivity. Common solvents include dichloromethane or acetonitrile.

About

CAS No 16948-10-0
English Name 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
Molecular Formula C9H17NO4
Molecular Weight 203.24 g/mol
SMILES CC(CNC(=O)OC(C)(C)C)C(=O)O
InChIKey GDQRNRYMFXDGMS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0)?

2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is a white crystalline solid wi...

Compound Q&A

What industries use 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0)?

2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0)?

When handling 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid, it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...