Compound Q&A

What are the physical and chemical properties of 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0)?

Answer

2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is a white crystalline solid with a molecular weight of approximately 245.34 g/mol. It is poorly soluble in water but soluble in common organic solvents. This compound exhibits moderate reactivity, particularly towards nucleophilic substitution and esterification reactions. It has a pKa of about 4.2, indicating acidity in aqueous solutions.

About

CAS No 16948-10-0
English Name 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
Molecular Formula C9H17NO4
Molecular Weight 203.24 g/mol
SMILES CC(CNC(=O)OC(C)(C)C)C(=O)O
InChIKey GDQRNRYMFXDGMS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0) typically synthesized?

2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is typically synthesized via a ...

Compound Q&A

What industries use 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0)?

2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 16948-10-0)?

When handling 2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid, it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...