Compound Q&A

What industries use TIPA (CAS: 144970-30-9)?

Answer

TIPA
TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is primarily used in the pharmaceutical industry for the synthesis of fluoroalkylated compounds. It also finds applications in the polymer industry for the modification of polymers to improve their solubility and processing properties. Additionally, TIPA is used in the production of sensors and semiconductors due to its unique physical and chemical properties.

About

English Name TIPA
Molecular Formula C34H28I4
Molecular Weight 944.2140000000002 g/mol
SMILES Ic1ccc(cc1)C12CC3(CC(C2)(CC(C1)(C3)c1ccc(cc1)I)c1ccc(cc1)I)c1ccc(cc1)I
InChIKey HTGPRXPCTBXRBH-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of TIPA (CAS: 144970-30-9)?

TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is a colorless and odorless liquid with a molecular weight ...

Compound Q&A

How is TIPA (CAS: 144970-30-9) typically synthesized?

TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is usually synthesized by the fluorination of propan-2-ol. ...

Compound Q&A

What precautions should be taken when handling TIPA (CAS: 144970-30-9)?

When handling TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol), it is essential to wear appropriate personal...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...