Compound Q&A

How is TIPA (CAS: 144970-30-9) typically synthesized?

Answer

TIPA
TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is usually synthesized by the fluorination of propan-2-ol. This process involves the reaction of propan-2-ol with fluorine gas in the presence of a Lewis acid catalyst, such as iron (III) chloride or aluminum chloride. The reaction is conducted under anhydrous conditions to prevent side reactions. The yield of TIPA can be as high as 85-90%, with good selectivity towards the desired product.

About

English Name TIPA
Molecular Formula C34H28I4
Molecular Weight 944.2140000000002 g/mol
SMILES Ic1ccc(cc1)C12CC3(CC(C2)(CC(C1)(C3)c1ccc(cc1)I)c1ccc(cc1)I)c1ccc(cc1)I
InChIKey HTGPRXPCTBXRBH-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of TIPA (CAS: 144970-30-9)?

TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is a colorless and odorless liquid with a molecular weight ...

Compound Q&A

What industries use TIPA (CAS: 144970-30-9)?

TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling TIPA (CAS: 144970-30-9)?

When handling TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol), it is essential to wear appropriate personal...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...