Compound Q&A

What are the physical and chemical properties of TIPA (CAS: 144970-30-9)?

Answer

TIPA
TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is a colorless and odorless liquid with a molecular weight of approximately 166.07 g/mol. It has a high solubility in common organic solvents but is practically insoluble in water. TIPA is relatively stable in air and does not readily react with common reagents, but it can hydrolyze slowly over time to form hexafluoroisopropanol. It exists as a crystalline solid at low temperatures and has a specific gravity of about 1.49 at 20°C.

About

English Name TIPA
Molecular Formula C34H28I4
Molecular Weight 944.2140000000002 g/mol
SMILES Ic1ccc(cc1)C12CC3(CC(C2)(CC(C1)(C3)c1ccc(cc1)I)c1ccc(cc1)I)c1ccc(cc1)I
InChIKey HTGPRXPCTBXRBH-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is TIPA (CAS: 144970-30-9) typically synthesized?

TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is usually synthesized by the fluorination of propan-2-ol. ...

Compound Q&A

What industries use TIPA (CAS: 144970-30-9)?

TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol) is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling TIPA (CAS: 144970-30-9)?

When handling TIPA (1,1,1,3,3,3-Hexafluoropropan-2-ol), it is essential to wear appropriate personal...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...