Compound Q&A

How is 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5) typically synthesized?

Answer

1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate
1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate is typically synthesized through a multistep process involving the reaction of 1-butyl-3-methylimidazolium chloride with sodium octyl sulfate. The synthesis yields a product with high purity and selectivity. The reaction involves the use of a solvent and is conducted under mild conditions to ensure optimal yield and purity.

About

English Name 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate
Molecular Formula C16H32N2O4S
Molecular Weight 348.5 g/mol
SMILES CCCCCCCCOS(=O)(=O)[O-].CCCCN1C=C[N+](=C1)C
InChIKey KIDIBVPFLKLKAH-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5)?

1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5) is a crystalline solid with a mo...

Compound Q&A

What industries use 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5)?

1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5) is predominantly used in the pha...

Compound Q&A

What precautions should be taken when handling 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5)?

When handling 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5), it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...